C26H32Cl2N2O2S — CID 23531232
2,6-dichloro-N-[4-[2-[[1-(3-methylsulfanylpropyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide (PubChem CID 23531232) has the molecular formula C26H32Cl2N2O2S and a molecular weight of 507.53 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[2-[[1-(3-methylsulfanylpropyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[2-[[1-(3-methylsulfanylpropyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23531232 |
| Molecular Formula | C26H32Cl2N2O2S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2,6-dichloro-N-[4-[2-[[1-(3-methylsulfanylpropyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide |
| SMILES | CSCCCC1(C(=O)NC(C)Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)CCCC1 |
| InChI | InChI=1S/C26H32Cl2N2O2S/c1-18(29-25(32)26(13-3-4-14-26)15-6-16-33-2)17-19-9-11-20(12-10-19)30-24(31)23-21(27)7-5-8-22(23)28/h5,7-12,18H,3-4,6,13-17H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | LRKNHWQVUGENGS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|