C27H34Cl2N2O2S — CID 23531245
2,6-dichloro-N-[4-[2-[[1-(4-methylsulfanylbutyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide (PubChem CID 23531245) has the molecular formula C27H34Cl2N2O2S and a molecular weight of 521.55 g/mol. Its IUPAC name is 2,6-dichloro-N-[4-[2-[[1-(4-methylsulfanylbutyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide.
| Compound Name | 2,6-dichloro-N-[4-[2-[[1-(4-methylsulfanylbutyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23531245 |
| Molecular Formula | C27H34Cl2N2O2S |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2,6-dichloro-N-[4-[2-[[1-(4-methylsulfanylbutyl)cyclopentanecarbonyl]amino]propyl]phenyl]benzamide |
| SMILES | CSCCCCC1(C(=O)NC(C)Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)CCCC1 |
| InChI | InChI=1S/C27H34Cl2N2O2S/c1-19(30-26(33)27(14-3-4-15-27)16-5-6-17-34-2)18-20-10-12-21(13-11-20)31-25(32)24-22(28)8-7-9-23(24)29/h7-13,19H,3-6,14-18H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | FPQMRKMJDXAYMC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|