C25H28Cl2N2O5S2 — CID 12042622
(2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(3-methylsulfonylpropyl)cyclobutanecarbothioyl]amino]propanoic acid (PubChem CID 12042622) has the molecular formula C25H28Cl2N2O5S2 and a molecular weight of 571.55 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(3-methylsulfonylpropyl)cyclobutanecarbothioyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(3-methylsulfonylpropyl)cyclobutanecarbothioyl]amino]propanoic acid |
|---|---|
| PubChem CID | 12042622 |
| Molecular Formula | C25H28Cl2N2O5S2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[1-(3-methylsulfonylpropyl)cyclobutanecarbothioyl]amino]propanoic acid |
| SMILES | CS(=O)(=O)CCCC1(C(=S)N[C@@H](Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)C(=O)O)CCC1 |
| InChI | InChI=1S/C25H28Cl2N2O5S2/c1-36(33,34)14-4-13-25(11-3-12-25)24(35)29-20(23(31)32)15-16-7-9-17(10-8-16)28-22(30)21-18(26)5-2-6-19(21)27/h2,5-10,20H,3-4,11-15H2,1H3,(H,28,30)(H,29,35)(H,31,32)/t20-/m0/s1 |
| InChIKey | GTWMMQOXVSDMSN-FQEVSTJZSA-N |
| XLogP | 5.15 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|