C26H28Cl2N2O6 — CID 59920213
cis-(1R,3R)-3-[[(1R)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]carbamoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 59920213) has the molecular formula C26H28Cl2N2O6 and a molecular weight of 535.42 g/mol. Its IUPAC name is cis-(1R,3R)-3-[[(1R)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]carbamoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-3-[[(1R)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]carbamoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 59920213 |
| Molecular Formula | C26H28Cl2N2O6 |
| Molecular Weight | 535.42 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | cis-(1R,3R)-3-[[(1R)-1-carboxy-2-[4-[(2,6-dichlorobenzoyl)amino]phenyl]ethyl]carbamoyl]-2,2,3-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)O)CC[C@@]1(C)C(=O)N[C@H](Cc1ccc(NC(=O)c2c(Cl)cccc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C26H28Cl2N2O6/c1-25(2)16(22(32)33)11-12-26(25,3)24(36)30-19(23(34)35)13-14-7-9-15(10-8-14)29-21(31)20-17(27)5-4-6-18(20)28/h4-10,16,19H,11-13H2,1-3H3,(H,29,31)(H,30,36)(H,32,33)(H,34,35)/t16-,19+,26-/m0/s1 |
| InChIKey | VVTNYZYFDQSDFR-NNCILOIOSA-N |
| XLogP | 4.88 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |