C28H28Cl2N2Na2O6 — CID 22898718
disodium;(2S)-2-[[(1S,3R)-3-[(E)-2-carboxylatoethenyl]-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate (PubChem CID 22898718) has the molecular formula C28H28Cl2N2Na2O6 and a molecular weight of 605.43 g/mol. Its IUPAC name is disodium;(2S)-2-[[(1S,3R)-3-[(E)-2-carboxylatoethenyl]-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate.
| Compound Name | disodium;(2S)-2-[[(1S,3R)-3-[(E)-2-carboxylatoethenyl]-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 22898718 |
| Molecular Formula | C28H28Cl2N2Na2O6 |
| Molecular Weight | 605.43 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | disodium;(2S)-2-[[(1S,3R)-3-[(E)-2-carboxylatoethenyl]-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]propanoate |
| SMILES | CC1(C)[C@@H](C(=O)N[C@@H](Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)C(=O)[O-])CC[C@]1(C)/C=C/C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C28H30Cl2N2O6.2Na/c1-27(2)18(11-13-28(27,3)14-12-22(33)34)24(35)32-21(26(37)38)15-16-7-9-17(10-8-16)31-25(36)23-19(29)5-4-6-20(23)30;;/h4-10,12,14,18,21H,11,13,15H2,1-3H3,(H,31,36)(H,32,35)(H,33,34)(H,37,38);;/q;2*+1/p-2/b14-12+;;/t18-,21+,28-;;/m1../s1 |
| InChIKey | OYMGTZIJPLEBSC-FKBBFGFWSA-L |
| XLogP | -3.22 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.43 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|