C29H32Cl2N4O5 — CID 22898788
3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[3-(2-isocyanoethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]propanoic acid (PubChem CID 22898788) has the molecular formula C29H32Cl2N4O5 and a molecular weight of 587.50 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[3-(2-isocyanoethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[3-(2-isocyanoethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22898788 |
| Molecular Formula | C29H32Cl2N4O5 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[3-(2-isocyanoethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]propanoic acid |
| SMILES | [C-]#[N+]CCNC(=O)C1(C)CCC(C(=O)NC(Cc2ccc(NC(=O)c3c(Cl)cccc3Cl)cc2)C(=O)O)C1(C)C |
| InChI | InChI=1S/C29H32Cl2N4O5/c1-28(2)19(12-13-29(28,3)27(40)33-15-14-32-4)24(36)35-22(26(38)39)16-17-8-10-18(11-9-17)34-25(37)23-20(30)6-5-7-21(23)31/h5-11,19,22H,12-16H2,1-3H3,(H,33,40)(H,34,37)(H,35,36)(H,38,39) |
| InChIKey | HGOUSYDANCKGLU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|