C28H32Cl2N2O7 — CID 59077076
(2S)-2-[[(1S,3R)-3-(carboxymethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propanoic acid (PubChem CID 59077076) has the molecular formula C28H32Cl2N2O7 and a molecular weight of 579.48 g/mol. Its IUPAC name is (2S)-2-[[(1S,3R)-3-(carboxymethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(1S,3R)-3-(carboxymethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59077076 |
| Molecular Formula | C28H32Cl2N2O7 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | (2S)-2-[[(1S,3R)-3-(carboxymethylcarbamoyl)-2,2,3-trimethylcyclopentanecarbonyl]amino]-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propanoic acid |
| SMILES | CC1(C)[C@@H](C(=O)N[C@@H](Cc2ccc(OCc3c(Cl)cccc3Cl)cc2)C(=O)O)CC[C@@]1(C)C(=O)NCC(=O)O |
| InChI | InChI=1S/C28H32Cl2N2O7/c1-27(2)19(11-12-28(27,3)26(38)31-14-23(33)34)24(35)32-22(25(36)37)13-16-7-9-17(10-8-16)39-15-18-20(29)5-4-6-21(18)30/h4-10,19,22H,11-15H2,1-3H3,(H,31,38)(H,32,35)(H,33,34)(H,36,37)/t19-,22+,28+/m1/s1 |
| InChIKey | MXGSWWAVLGCSGS-IMXIINTDSA-N |
| XLogP | 4.33 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |