C31H33Cl2N3O6 — CID 10304424
(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 10304424) has the molecular formula C31H33Cl2N3O6 and a molecular weight of 614.53 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10304424 |
| Molecular Formula | C31H33Cl2N3O6 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | COc1ccc(NNC(=O)C2CCC(C(=O)N[C@@H](Cc3ccc(OCc4c(Cl)cccc4Cl)cc3)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C31H33Cl2N3O6/c1-41-23-15-11-22(12-16-23)35-36-30(38)21-9-7-20(8-10-21)29(37)34-28(31(39)40)17-19-5-13-24(14-6-19)42-18-25-26(32)3-2-4-27(25)33/h2-6,11-16,20-21,28,35H,7-10,17-18H2,1H3,(H,34,37)(H,36,38)(H,39,40)/t20?,21?,28-/m0/s1 |
| InChIKey | XZFNEHTYJFOBQA-ZAFMFWTISA-N |
| XLogP | 5.64 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|