C31H30Cl2F3N3O6 — CID 10146440
(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 10146440) has the molecular formula C31H30Cl2F3N3O6 and a molecular weight of 668.50 g/mol. Its IUPAC name is (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10146440 |
| Molecular Formula | C31H30Cl2F3N3O6 |
| Molecular Weight | 668.50 g/mol |
| Exact Mass | 667.15 |
| IUPAC Name | (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[4-[[4-(trifluoromethoxy)anilino]carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | O=C(NNc1ccc(OC(F)(F)F)cc1)C1CCC(C(=O)N[C@@H](Cc2ccc(OCc3c(Cl)cccc3Cl)cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C31H30Cl2F3N3O6/c32-25-2-1-3-26(33)24(25)17-44-22-12-4-18(5-13-22)16-27(30(42)43)37-28(40)19-6-8-20(9-7-19)29(41)39-38-21-10-14-23(15-11-21)45-31(34,35)36/h1-5,10-15,19-20,27,38H,6-9,16-17H2,(H,37,40)(H,39,41)(H,42,43)/t19?,20?,27-/m0/s1 |
| InChIKey | JXXISHOFFHRUQT-IRQSHYTFSA-N |
| XLogP | 6.53 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|