C32H37N3O5 — CID 59085945
3-[4-(2,6-dimethylphenyl)phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 59085945) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is 3-[4-(2,6-dimethylphenyl)phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | 3-[4-(2,6-dimethylphenyl)phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59085945 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 3-[4-(2,6-dimethylphenyl)phenyl]-2-[[4-[(4-methoxyanilino)carbamoyl]cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | COc1ccc(NNC(=O)C2CCC(C(=O)NC(Cc3ccc(-c4c(C)cccc4C)cc3)C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C32H37N3O5/c1-20-5-4-6-21(2)29(20)23-9-7-22(8-10-23)19-28(32(38)39)33-30(36)24-11-13-25(14-12-24)31(37)35-34-26-15-17-27(40-3)18-16-26/h4-10,15-18,24-25,28,34H,11-14,19H2,1-3H3,(H,33,36)(H,35,37)(H,38,39) |
| InChIKey | GTOOFEAXPKCHIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|