C24H30N2O6S — CID 57011030
(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoic acid (PubChem CID 57011030) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is (2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 57011030 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-[4-(4-methylphenyl)sulfonyloxyphenyl]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C[C@H](NC(=O)C3CCC(CN)CC3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-16-2-12-21(13-3-16)33(30,31)32-20-10-6-17(7-11-20)14-22(24(28)29)26-23(27)19-8-4-18(15-25)5-9-19/h2-3,6-7,10-13,18-19,22H,4-5,8-9,14-15,25H2,1H3,(H,26,27)(H,28,29)/t18?,19?,22-/m0/s1 |
| InChIKey | TUISRVSEITZLBA-AJTFCVKESA-N |
| XLogP | 2.64 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|