C24H25NO7S2 — CID 162418962
3-[(4-methylphenyl)sulfonylamino]-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoic acid (PubChem CID 162418962) has the molecular formula C24H25NO7S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoic acid.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 162418962 |
| Molecular Formula | C24H25NO7S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-4-[4-(4-methylphenyl)sulfonyloxyphenyl]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(=O)O)Cc2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H25NO7S2/c1-17-3-11-22(12-4-17)33(28,29)25-20(16-24(26)27)15-19-7-9-21(10-8-19)32-34(30,31)23-13-5-18(2)6-14-23/h3-14,20,25H,15-16H2,1-2H3,(H,26,27) |
| InChIKey | QIDOEDQDEIQTFW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|