C17H16F3NO5S — CID 170430308
(3R)-4-phenyl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoic acid (PubChem CID 170430308) has the molecular formula C17H16F3NO5S and a molecular weight of 403.38 g/mol. Its IUPAC name is (3R)-4-phenyl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoic acid.
| Compound Name | (3R)-4-phenyl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 170430308 |
| Molecular Formula | C17H16F3NO5S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (3R)-4-phenyl-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoic acid |
| SMILES | O=C(O)C[C@@H](Cc1ccccc1)NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO5S/c18-17(19,20)26-14-6-8-15(9-7-14)27(24,25)21-13(11-16(22)23)10-12-4-2-1-3-5-12/h1-9,13,21H,10-11H2,(H,22,23)/t13-/m1/s1 |
| InChIKey | RNAPYIAPJKKKQX-CYBMUJFWSA-N |
| XLogP | 2.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |