C16H15F3N2O5S — CID 170430265
[(2S)-2-phenyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamic acid (PubChem CID 170430265) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is [(2S)-2-phenyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamic acid.
| Compound Name | [(2S)-2-phenyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamic acid |
|---|---|
| PubChem CID | 170430265 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [(2S)-2-phenyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]carbamic acid |
| SMILES | O=C(O)NC[C@@H](NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H15F3N2O5S/c17-16(18,19)26-12-6-8-13(9-7-12)27(24,25)21-14(10-20-15(22)23)11-4-2-1-3-5-11/h1-9,14,20-21H,10H2,(H,22,23)/t14-/m1/s1 |
| InChIKey | OMIVHQODIVOCCZ-CQSZACIVSA-N |
| XLogP | 2.87 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |