C19H20F3NO5S — CID 164862354
ethyl 3-(4-methylphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate (PubChem CID 164862354) has the molecular formula C19H20F3NO5S and a molecular weight of 431.43 g/mol. Its IUPAC name is ethyl 3-(4-methylphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate.
| Compound Name | ethyl 3-(4-methylphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 164862354 |
| Molecular Formula | C19H20F3NO5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | ethyl 3-(4-methylphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20F3NO5S/c1-3-27-18(24)12-17(14-6-4-13(2)5-7-14)23-29(25,26)16-10-8-15(9-11-16)28-19(20,21)22/h4-11,17,23H,3,12H2,1-2H3 |
| InChIKey | KLWFCLOUDDYPTR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |