C14H18F3NO5S — CID 2809519
ethyl 3-methyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoate (PubChem CID 2809519) has the molecular formula C14H18F3NO5S and a molecular weight of 369.36 g/mol. Its IUPAC name is ethyl 3-methyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoate.
| Compound Name | ethyl 3-methyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2809519 |
| Molecular Formula | C14H18F3NO5S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 3-methyl-2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]butanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C14H18F3NO5S/c1-4-22-13(19)12(9(2)3)18-24(20,21)11-7-5-10(6-8-11)23-14(15,16)17/h5-9,12,18H,4H2,1-3H3 |
| InChIKey | WFDBQMWISXHQPJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |