C14H16F3NO7S — CID 3716840
diethyl 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanedioate (PubChem CID 3716840) has the molecular formula C14H16F3NO7S and a molecular weight of 399.34 g/mol. Its IUPAC name is diethyl 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanedioate.
| Compound Name | diethyl 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 3716840 |
| Molecular Formula | C14H16F3NO7S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | diethyl 2-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanedioate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)C(=O)OCC |
| InChI | InChI=1S/C14H16F3NO7S/c1-3-23-12(19)11(13(20)24-4-2)18-26(21,22)10-7-5-9(6-8-10)25-14(15,16)17/h5-8,11,18H,3-4H2,1-2H3 |
| InChIKey | ASBPOPKICDTQPQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|