C20H22F3NO6S — CID 174236136
ethyl 3-(2-ethoxyphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate (PubChem CID 174236136) has the molecular formula C20H22F3NO6S and a molecular weight of 461.46 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate.
| Compound Name | ethyl 3-(2-ethoxyphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 174236136 |
| Molecular Formula | C20H22F3NO6S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | ethyl 3-(2-ethoxyphenyl)-3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]propanoate |
| SMILES | CCOC(=O)CC(NS(=O)(=O)c1ccc(OC(F)(F)F)cc1)c1ccccc1OCC |
| InChI | InChI=1S/C20H22F3NO6S/c1-3-28-18-8-6-5-7-16(18)17(13-19(25)29-4-2)24-31(26,27)15-11-9-14(10-12-15)30-20(21,22)23/h5-12,17,24H,3-4,13H2,1-2H3 |
| InChIKey | SFMKHSGPJPPQAD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |