C18H16F3NO4S — CID 90575449
N-[4-(2-methylphenoxy)but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 90575449) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is N-[4-(2-methylphenoxy)but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-(2-methylphenoxy)but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 90575449 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[4-(2-methylphenoxy)but-2-ynyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1ccccc1OCC#CCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO4S/c1-14-6-2-3-7-17(14)25-13-5-4-12-22-27(23,24)16-10-8-15(9-11-16)26-18(19,20)21/h2-3,6-11,22H,12-13H2,1H3 |
| InChIKey | HYEUUMRMXMWUDP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|