C20H15F3N2O4S — CID 90580361
N-(4-quinolin-7-yloxybut-2-ynyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 90580361) has the molecular formula C20H15F3N2O4S and a molecular weight of 436.41 g/mol. Its IUPAC name is N-(4-quinolin-7-yloxybut-2-ynyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(4-quinolin-7-yloxybut-2-ynyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 90580361 |
| Molecular Formula | C20H15F3N2O4S |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-(4-quinolin-7-yloxybut-2-ynyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCC#CCOc1ccc2cccnc2c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N2O4S/c21-20(22,23)29-16-7-9-18(10-8-16)30(26,27)25-12-1-2-13-28-17-6-5-15-4-3-11-24-19(15)14-17/h3-11,14,25H,12-13H2 |
| InChIKey | WESTXTACPNCPFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|