C17H15F3N2O3S — CID 90579556
N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90579556) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90579556 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[4-[(6-methyl-3-pyridinyl)oxy]but-2-ynyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(OCC#CCNS(=O)(=O)c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C17H15F3N2O3S/c1-13-4-7-15(12-21-13)25-11-3-2-10-22-26(23,24)16-8-5-14(6-9-16)17(18,19)20/h4-9,12,22H,10-11H2,1H3 |
| InChIKey | ATPSMNYYIVAQTM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|