C21H20F3NO3S — CID 90576066
N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 90576066) has the molecular formula C21H20F3NO3S and a molecular weight of 423.46 g/mol. Its IUPAC name is N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 90576066 |
| Molecular Formula | C21H20F3NO3S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC#CCOc1cccc(C(F)(F)F)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H20F3NO3S/c22-21(23,24)18-8-5-9-19(15-18)28-13-4-3-12-25-29(26,27)20-11-10-16-6-1-2-7-17(16)14-20/h5,8-11,14-15,25H,1-2,6-7,12-13H2 |
| InChIKey | NLMFTSAELUDNCZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|