C16H14F3NO3S2 — CID 90576044
5-methyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]thiophene-2-sulfonamide (PubChem CID 90576044) has the molecular formula C16H14F3NO3S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-methyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90576044 |
| Molecular Formula | C16H14F3NO3S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 5-methyl-N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC#CCOc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C16H14F3NO3S2/c1-12-7-8-15(24-12)25(21,22)20-9-2-3-10-23-14-6-4-5-13(11-14)16(17,18)19/h4-8,11,20H,9-10H2,1H3 |
| InChIKey | AGRDHKABLNTCAM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|