C19H15F6NO3S — CID 90576082
N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1-[4-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 90576082) has the molecular formula C19H15F6NO3S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1-[4-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90576082 |
| Molecular Formula | C19H15F6NO3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[4-[3-(trifluoromethyl)phenoxy]but-2-ynyl]-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(C(F)(F)F)cc1)NCC#CCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F6NO3S/c20-18(21,22)15-8-6-14(7-9-15)13-30(27,28)26-10-1-2-11-29-17-5-3-4-16(12-17)19(23,24)25/h3-9,12,26H,10-11,13H2 |
| InChIKey | TYYOIILRIWSZBE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|