C10H13F3N2O2S — CID 167065322
N-(methylaminomethyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 167065322) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is N-(methylaminomethyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(methylaminomethyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 167065322 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(methylaminomethyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CNCNS(=O)(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H13F3N2O2S/c1-14-7-15-18(16,17)6-8-2-4-9(5-3-8)10(11,12)13/h2-5,14-15H,6-7H2,1H3 |
| InChIKey | UKDGQLXBJCYLSS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|