C15H16F3NO3S2 — CID 71796922
N-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 71796922) has the molecular formula C15H16F3NO3S2 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 71796922 |
| Molecular Formula | C15H16F3NO3S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-1-[4-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)Cc1ccc(C(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H16F3NO3S2/c1-14(20,13-3-2-8-23-13)10-19-24(21,22)9-11-4-6-12(7-5-11)15(16,17)18/h2-8,19-20H,9-10H2,1H3 |
| InChIKey | XRJPYPZIDZDNCY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |