C15H17NO3S2 — CID 90500202
(E)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-phenylethenesulfonamide (PubChem CID 90500202) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (E)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-phenylethenesulfonamide.
| Compound Name | (E)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 90500202 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (E)-N-(2-hydroxy-2-thiophen-2-ylpropyl)-2-phenylethenesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)/C=C/c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H17NO3S2/c1-15(17,14-8-5-10-20-14)12-16-21(18,19)11-9-13-6-3-2-4-7-13/h2-11,16-17H,12H2,1H3/b11-9+ |
| InChIKey | OFWPXWLAPGFQES-PKNBQFBNSA-N |
| XLogP | 2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |