C14H21NO3S2 — CID 95984419
(E)-N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-2-phenylethenesulfonamide (PubChem CID 95984419) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (E)-N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 95984419 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (E)-N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]-2-phenylethenesulfonamide |
| SMILES | CSCC[C@](C)(O)CNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H21NO3S2/c1-14(16,9-10-19-2)12-15-20(17,18)11-8-13-6-4-3-5-7-13/h3-8,11,15-16H,9-10,12H2,1-2H3/b11-8+/t14-/m0/s1 |
| InChIKey | UOHIBHLJDJOVLY-ZHZWZMEUSA-N |
| XLogP | 2.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |