C13H19NO3S2 — CID 103834908
(E)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-phenylethenesulfonamide (PubChem CID 103834908) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (E)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 103834908 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (E)-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-phenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)NCCSCCCO |
| InChI | InChI=1S/C13H19NO3S2/c15-9-4-10-18-11-8-14-19(16,17)12-7-13-5-2-1-3-6-13/h1-3,5-7,12,14-15H,4,8-11H2/b12-7+ |
| InChIKey | JMIPXNQAGFPEDJ-KPKJPENVSA-N |
| XLogP | 1.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|