C16H25N2O2S+ — CID 8823993
(E)-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)ethenesulfonamide (PubChem CID 8823993) has the molecular formula C16H25N2O2S+ and a molecular weight of 309.45 g/mol. Its IUPAC name is (E)-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)ethenesulfonamide.
| Compound Name | (E)-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)ethenesulfonamide |
|---|---|
| PubChem CID | 8823993 |
| Molecular Formula | C16H25N2O2S+ |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (E)-2-phenyl-N-(3-piperidin-1-ium-1-ylpropyl)ethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)NCCC[NH+]1CCCCC1 |
| InChI | InChI=1S/C16H24N2O2S/c19-21(20,15-10-16-8-3-1-4-9-16)17-11-7-14-18-12-5-2-6-13-18/h1,3-4,8-10,15,17H,2,5-7,11-14H2/p+1/b15-10+ |
| InChIKey | MGXVQVPEYCRZKK-XNTDXEJSSA-O |
| XLogP | 1.04 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|