C14H21NO4S — CID 47121888
(E)-N-[3-(2-methoxyethoxy)propyl]-2-phenylethenesulfonamide (PubChem CID 47121888) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (E)-N-[3-(2-methoxyethoxy)propyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[3-(2-methoxyethoxy)propyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 47121888 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (E)-N-[3-(2-methoxyethoxy)propyl]-2-phenylethenesulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S/c1-18-11-12-19-10-5-9-15-20(16,17)13-8-14-6-3-2-4-7-14/h2-4,6-8,13,15H,5,9-12H2,1H3/b13-8+ |
| InChIKey | RCTFBBUVKTVGBK-MDWZMJQESA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|