C20H32N2O4S — CID 42910795
N-(3-butoxypropyl)-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide (PubChem CID 42910795) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide.
| Compound Name | N-(3-butoxypropyl)-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 42910795 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-(3-butoxypropyl)-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
| SMILES | CCCCOCCCNC(=O)C(NS(=O)(=O)/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H32N2O4S/c1-4-5-14-26-15-9-13-21-20(23)19(17(2)3)22-27(24,25)16-12-18-10-7-6-8-11-18/h6-8,10-12,16-17,19,22H,4-5,9,13-15H2,1-3H3,(H,21,23)/b16-12+ |
| InChIKey | SHGOMEISRMZDHS-FOWTUZBSSA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|