C23H27N3O3S2 — CID 24548850
(2S)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide (PubChem CID 24548850) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is (2S)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide.
| Compound Name | (2S)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 24548850 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (2S)-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-methyl-2-[[(E)-2-phenylethenyl]sulfonylamino]butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)/C=C/c1ccccc1)C(=O)NCCSCc1ccccc1C#N |
| InChI | InChI=1S/C23H27N3O3S2/c1-18(2)22(26-31(28,29)15-12-19-8-4-3-5-9-19)23(27)25-13-14-30-17-21-11-7-6-10-20(21)16-24/h3-12,15,18,22,26H,13-14,17H2,1-2H3,(H,25,27)/b15-12+/t22-/m0/s1 |
| InChIKey | FLFVRRKWGQEJRS-GLBTYYSXSA-N |
| XLogP | 3.52 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|