C21H24N2O3S2 — CID 46460118
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide (PubChem CID 46460118) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 46460118 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-(3-phenylpropylsulfonyl)acetamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)CS(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C21H24N2O3S2/c22-15-19-10-4-5-11-20(19)16-27-13-12-23-21(24)17-28(25,26)14-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-11H,6,9,12-14,16-17H2,(H,23,24) |
| InChIKey | QGQDUWRDZQTTOY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|