C23H29N3O3S2 — CID 46448957
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide (PubChem CID 46448957) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46448957 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-3-[4-(diethylsulfamoyl)phenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)NCCSCc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-3-26(4-2)31(28,29)22-12-9-19(10-13-22)11-14-23(27)25-15-16-30-18-21-8-6-5-7-20(21)17-24/h5-10,12-13H,3-4,11,14-16,18H2,1-2H3,(H,25,27) |
| InChIKey | HZKVMDOAZBLZBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|