C19H19FN2OS2 — CID 24548844
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 24548844) has the molecular formula C19H19FN2OS2 and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 24548844 |
| Molecular Formula | C19H19FN2OS2 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | N#Cc1ccccc1CSCCNC(=O)CSCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2OS2/c20-18-7-5-15(6-8-18)12-25-14-19(23)22-9-10-24-13-17-4-2-1-3-16(17)11-21/h1-8H,9-10,12-14H2,(H,22,23) |
| InChIKey | LXDLLPYPPHAHCG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|