C22H20ClFN4OS — CID 46698990
5-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-1-[(4-fluorophenyl)methyl]-3-methylpyrazole-4-carboxamide (PubChem CID 46698990) has the molecular formula C22H20ClFN4OS and a molecular weight of 442.95 g/mol. Its IUPAC name is 5-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-1-[(4-fluorophenyl)methyl]-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-1-[(4-fluorophenyl)methyl]-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46698990 |
| Molecular Formula | C22H20ClFN4OS |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 5-chloro-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-1-[(4-fluorophenyl)methyl]-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c(Cl)c1C(=O)NCCSCc1ccccc1C#N |
| InChI | InChI=1S/C22H20ClFN4OS/c1-15-20(21(23)28(27-15)13-16-6-8-19(24)9-7-16)22(29)26-10-11-30-14-18-5-3-2-4-17(18)12-25/h2-9H,10-11,13-14H2,1H3,(H,26,29) |
| InChIKey | HQKDKFZOJQBLQY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|