C19H20FN3O3S2 — CID 17467467
N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 17467467) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 17467467 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NCCSCc1ccccc1C#N)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O3S2/c1-23(28(25,26)18-8-6-17(20)7-9-18)13-19(24)22-10-11-27-14-16-5-3-2-4-15(16)12-21/h2-9H,10-11,13-14H2,1H3,(H,22,24) |
| InChIKey | YGIGLMHZXOKMQE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|