C17H19N3O3S3 — CID 46541498
2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 46541498) has the molecular formula C17H19N3O3S3 and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46541498 |
| Molecular Formula | C17H19N3O3S3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | CN(CC(=O)NCCSCc1cccs1)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H19N3O3S3/c1-20(26(22,23)16-6-4-14(11-18)5-7-16)12-17(21)19-8-10-24-13-15-3-2-9-25-15/h2-7,9H,8,10,12-13H2,1H3,(H,19,21) |
| InChIKey | BZLXOBBQPNJDIJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|