C17H15ClN4O4S — CID 32925814
N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-cyano-N-methylbenzenesulfonamide (PubChem CID 32925814) has the molecular formula C17H15ClN4O4S and a molecular weight of 406.85 g/mol. Its IUPAC name is N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-cyano-N-methylbenzenesulfonamide.
| Compound Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-cyano-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 32925814 |
| Molecular Formula | C17H15ClN4O4S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-cyano-N-methylbenzenesulfonamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1Cl)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15ClN4O4S/c1-22(27(25,26)13-8-6-12(10-19)7-9-13)11-16(23)20-21-17(24)14-4-2-3-5-15(14)18/h2-9H,11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ZUHIKJLLRYTVII-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|