C16H15ClFN3O4S — CID 9339527
N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 9339527) has the molecular formula C16H15ClFN3O4S and a molecular weight of 399.83 g/mol. Its IUPAC name is N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9339527 |
| Molecular Formula | C16H15ClFN3O4S |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccccc1Cl)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15ClFN3O4S/c1-21(26(24,25)12-8-6-11(18)7-9-12)10-15(22)19-20-16(23)13-4-2-3-5-14(13)17/h2-9H,10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | AKUNVSHMIHVFIX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|