C22H18ClFN2O4S — CID 45372617
N-(2-benzoyl-4-chlorophenyl)-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 45372617) has the molecular formula C22H18ClFN2O4S and a molecular weight of 460.91 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 45372617 |
| Molecular Formula | C22H18ClFN2O4S |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[(4-fluorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18ClFN2O4S/c1-26(31(29,30)18-10-8-17(24)9-11-18)14-21(27)25-20-12-7-16(23)13-19(20)22(28)15-5-3-2-4-6-15/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | GNDICOFYNKDYAB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |