C24H22Cl2N2O5S — CID 30168164
N-(2-benzoyl-4-chlorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 30168164) has the molecular formula C24H22Cl2N2O5S and a molecular weight of 521.42 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 30168164 |
| Molecular Formula | C24H22Cl2N2O5S |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N2O5S/c1-3-33-21-12-10-18(26)14-22(21)34(31,32)28(2)15-23(29)27-20-11-9-17(25)13-19(20)24(30)16-7-5-4-6-8-16/h4-14H,3,15H2,1-2H3,(H,27,29) |
| InChIKey | NJEYGEAHIBJOKN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |