C13H19ClN2O5S — CID 30167910
2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]-N-(2-hydroxyethyl)acetamide (PubChem CID 30167910) has the molecular formula C13H19ClN2O5S and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 30167910 |
| Molecular Formula | C13H19ClN2O5S |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]-N-(2-hydroxyethyl)acetamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)NCCO |
| InChI | InChI=1S/C13H19ClN2O5S/c1-3-21-11-5-4-10(14)8-12(11)22(19,20)16(2)9-13(18)15-6-7-17/h4-5,8,17H,3,6-7,9H2,1-2H3,(H,15,18) |
| InChIKey | MOLKWXKYWFCLBQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |