C17H17BrClFN2O4S — CID 30168021
N-(4-bromo-2-fluorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 30168021) has the molecular formula C17H17BrClFN2O4S and a molecular weight of 479.76 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 30168021 |
| Molecular Formula | C17H17BrClFN2O4S |
| Molecular Weight | 479.76 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[(5-chloro-2-ethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H17BrClFN2O4S/c1-3-26-15-7-5-12(19)9-16(15)27(24,25)22(2)10-17(23)21-14-6-4-11(18)8-13(14)20/h4-9H,3,10H2,1-2H3,(H,21,23) |
| InChIKey | UVFWWNVNFPODGY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |