C23H20BrClN2O4S — CID 45372673
N-(2-benzoyl-4-chlorophenyl)-2-[(4-bromophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 45372673) has the molecular formula C23H20BrClN2O4S and a molecular weight of 535.85 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-[(4-bromophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-[(4-bromophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 45372673 |
| Molecular Formula | C23H20BrClN2O4S |
| Molecular Weight | 535.85 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-[(4-bromophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H20BrClN2O4S/c1-2-27(32(30,31)19-11-8-17(24)9-12-19)15-22(28)26-21-13-10-18(25)14-20(21)23(29)16-6-4-3-5-7-16/h3-14H,2,15H2,1H3,(H,26,28) |
| InChIKey | SFDKIGNSWIQWHL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.85 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |