C25H18ClFN2O4S2 — CID 43900835
N-(2-benzoyl-4-chlorophenyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 43900835) has the molecular formula C25H18ClFN2O4S2 and a molecular weight of 529.01 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43900835 |
| Molecular Formula | C25H18ClFN2O4S2 |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1cccs1)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18ClFN2O4S2/c26-18-12-13-21(19(15-18)25(31)17-7-2-1-3-8-17)28-23(30)16-29(22-10-5-4-9-20(22)27)35(32,33)24-11-6-14-34-24/h1-15H,16H2,(H,28,30) |
| InChIKey | ZSORNITYNWNTRM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |