C17H19FN2O3S2 — CID 30256064
N-cyclopentyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide (PubChem CID 30256064) has the molecular formula C17H19FN2O3S2 and a molecular weight of 382.48 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide.
| Compound Name | N-cyclopentyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 30256064 |
| Molecular Formula | C17H19FN2O3S2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-cyclopentyl-2-(2-fluoro-N-thiophen-2-ylsulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1cccs1)NC1CCCC1 |
| InChI | InChI=1S/C17H19FN2O3S2/c18-14-8-3-4-9-15(14)20(25(22,23)17-10-5-11-24-17)12-16(21)19-13-6-1-2-7-13/h3-5,8-11,13H,1-2,6-7,12H2,(H,19,21) |
| InChIKey | KHNAKCCJKUAWKG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |