C14H14FN3O5S — CID 9476624
4-fluoro-N-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide (PubChem CID 9476624) has the molecular formula C14H14FN3O5S and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-fluoro-N-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9476624 |
| Molecular Formula | C14H14FN3O5S |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-fluoro-N-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC(=O)NNC(=O)c1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FN3O5S/c1-18(24(21,22)11-6-4-10(15)5-7-11)9-13(19)16-17-14(20)12-3-2-8-23-12/h2-8H,9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | OUJXGOJYOYJOAB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|