C15H14FN3O4S — CID 9476583
N-(4-fluorophenyl)-2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylacetamide (PubChem CID 9476583) has the molecular formula C15H14FN3O4S and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9476583 |
| Molecular Formula | C15H14FN3O4S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl]sulfanylacetamide |
| SMILES | O=C(CSCC(=O)Nc1ccc(F)cc1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C15H14FN3O4S/c16-10-3-5-11(6-4-10)17-13(20)8-24-9-14(21)18-19-15(22)12-2-1-7-23-12/h1-7H,8-9H2,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | AIVWRYKQULGKRW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|